Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:36:09 UTC |
---|
Update Date | 2025-03-21 17:57:13 UTC |
---|
HMDB ID | HMDB0029521 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00006475 |
---|
Name | Norizalpinin |
---|
Frequency | 796.6 |
---|
Structure | |
---|
Chemical Formula | C15H10O5 |
---|
Molecular Mass | 270.0528 |
---|
SMILES | O=c1c(O)c(-c2ccccc2)oc2cc(O)cc(O)c12 |
---|
InChI Key | VCCRNZQBSJXYJD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavones |
---|
Direct Parent | flavonols |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
---|
Substituents | 3-hydroxyflavonemonocyclic benzene moiety3-hydroxyflavonoidbenzopyran1-benzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyran7-hydroxyflavonoidpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|