| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:10 UTC |
|---|
| Update Date | 2025-03-21 17:57:14 UTC |
|---|
| HMDB ID | HMDB0006229 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006534 |
|---|
| Name | 5-Diphosphoinositol pentakisphosphate |
|---|
| Frequency | 788.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H19O27P7 |
|---|
| Molecular Mass | 739.8277 |
|---|
| SMILES | O=P(O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | UPHPWXPNZIOZJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganic pyrophosphatesorganooxygen compounds |
|---|
| Substituents | inositol phosphateorganic pyrophosphateorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|