| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:12 UTC |
|---|
| Update Date | 2025-03-21 17:57:14 UTC |
|---|
| HMDB ID | HMDB0244465 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006582 |
|---|
| Name | 2-Amino-6-[(1R,2S)-1,2,3-trihydroxypropyl]-7,8-dihydro-3H-pteridin-4-one |
|---|
| Frequency | 809.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N5O4 |
|---|
| Molecular Mass | 255.0968 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(C(O)C(O)CO)=N2 |
|---|
| InChI Key | YQIFAMYNGGOTFB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesketiminesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | ketimineiminepyrimidonepyrimidinepropargyl-type 1,3-dipolar organic compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
