| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:17 UTC |
|---|
| Update Date | 2025-03-21 17:57:16 UTC |
|---|
| HMDB ID | HMDB0006334 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006784 |
|---|
| Name | 3-Dehydro-L-gulonate |
|---|
| Frequency | 756.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O7 |
|---|
| Molecular Mass | 194.0427 |
|---|
| SMILES | O=C(O)C(O)C(=O)C(O)C(O)CO |
|---|
| InChI Key | WTAHRPBPWHCMHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | medium-chain keto acids and derivatives |
|---|
| Direct Parent | medium-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacyloinsalpha hydroxy acids and derivativesalpha-hydroxy ketonesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsfatty acylshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidealpha-hydroxy ketonecarboxylic acid derivativebeta-keto acidketonesaccharideorganic oxidehydroxy fatty acidprimary alcoholalcoholhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivative1,3-dicarbonyl compoundorganooxygen compoundmedium-chain keto acid |
|---|
