| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:20 UTC |
|---|
| Update Date | 2025-03-21 17:57:17 UTC |
|---|
| HMDB ID | HMDB0258120 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006902 |
|---|
| Name | 3-Hydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxypropanoic acid |
|---|
| Frequency | 741.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H8O10P2 |
|---|
| Molecular Mass | 265.9593 |
|---|
| SMILES | O=C(O)C(CO)OP(=O)(O)OP(=O)(O)O |
|---|
| InChI Key | FBXBJGKRAGRTRC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organic oxoanionic compounds |
|---|
| Subclass | organic pyrophosphates |
|---|
| Direct Parent | organic pyrophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidhydroxy acidcarboxylic acid derivativeorganic pyrophosphatebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesphosphoric acid esterglyceric_acidmonoalkyl phosphatehydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
