| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:21 UTC |
|---|
| Update Date | 2025-03-21 17:57:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006938 |
|---|
| Frequency | 737.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14O7 |
|---|
| Molecular Mass | 210.074 |
|---|
| SMILES | OCC1(O)C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | RHEJYZFABVRCIW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativeshydrocarbon derivativestertiary alcohols |
|---|
| Substituents | tertiary alcoholcyclohexanolaliphatic homomonocyclic compoundcyclitol or derivativeshydrocarbon derivativecyclic alcohol |
|---|