| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:22 UTC |
|---|
| Update Date | 2025-03-21 17:57:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006975 |
|---|
| Frequency | 934.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7N5O2 |
|---|
| Molecular Mass | 181.06 |
|---|
| SMILES | CNc1nc(=O)c2[nH]c(=O)[nH]c2[nH]1 |
|---|
| InChI Key | CVOMRGUGVVOEDQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundspyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | pyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazolevinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
