| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:26 UTC |
|---|
| Update Date | 2025-03-21 17:57:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007117 |
|---|
| Frequency | 715.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O9 |
|---|
| Molecular Mass | 346.1264 |
|---|
| SMILES | COc1cc(C(O)CO)ccc1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | CKZZDMQZIJVUKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenol ethers |
|---|
| Subclass | anisoles |
|---|
| Direct Parent | anisoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersaromatic alcoholshydrocarbon derivativesmethoxybenzenesmonosaccharidesoxacyclic compoundsoxanesphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietyetheraromatic heteromonocyclic compoundmonosaccharidealkyl aryl ethermethoxybenzeneoxacyclesaccharideorganic oxygen compoundacetalanisolesecondary alcoholhydrocarbon derivativephenoxy compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|