| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:26 UTC |
|---|
| Update Date | 2025-03-21 17:57:19 UTC |
|---|
| HMDB ID | HMDB0004215 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007126 |
|---|
| Name | 3,3',4'5-Tetrahydroxystilbene |
|---|
| Frequency | 714.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O4 |
|---|
| Molecular Mass | 244.0736 |
|---|
| SMILES | Oc1cc(O)cc(C=Cc2ccc(O)c(O)c2)c1 |
|---|
| InChI Key | CDRPUGZCRXZLFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesorganooxygen compoundsresorcinols |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidphenolhydrocarbon derivativebenzenoid1-hydroxy-4-unsubstituted benzenoidorganooxygen compoundresorcinolstilbene |
|---|
