| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:26 UTC |
|---|
| Update Date | 2025-03-21 17:57:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007140 |
|---|
| Frequency | 713.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H25NO |
|---|
| Molecular Mass | 247.1936 |
|---|
| SMILES | CN(C)CC(c1ccccc1)C1(O)CCCCC1 |
|---|
| InChI Key | QOVGVRHIJYHFST-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsbenzene and substituted derivativescyclic alcohols and derivativeshydrocarbon derivativesorganopnictogen compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moiety1,3-aminoalcoholtertiary aliphatic aminecyclohexanolcyclic alcoholaromatic homomonocyclic compoundtertiary alcoholorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amine |
|---|
