Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:36:27 UTC |
---|
Update Date | 2025-03-21 17:57:20 UTC |
---|
HMDB ID | HMDB0041206 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00007187 |
---|
Name | Antibiotic SB 202742 |
---|
Frequency | 707.5 |
---|
Structure | |
---|
Chemical Formula | C24H34O3 |
---|
Molecular Mass | 370.2508 |
---|
SMILES | CCC=CCC=CCC=CCCCCCCCc1cccc(O)c1C(=O)O |
---|
InChI Key | MBYMHCHZLAJVRK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | salicylic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsvinylogous acids |
---|
Substituents | carboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound |
---|