| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:28 UTC |
|---|
| Update Date | 2025-03-21 17:57:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007215 |
|---|
| Frequency | 704.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15NO15S3 |
|---|
| Molecular Mass | 448.9604 |
|---|
| SMILES | COC1OC(COS(=O)(=O)O)C(OS(=O)(=O)O)C(O)C1NOS(=O)(=O)O |
|---|
| InChI Key | QSCRFFQVVFTLCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl sulfateshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoesterorganic sulfuric acid or derivativesmonosaccharideoxacycleorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundoxanesulfuric acid esterorganoheterocyclic compound |
|---|