| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:28 UTC |
|---|
| Update Date | 2025-03-21 17:57:20 UTC |
|---|
| HMDB ID | HMDB0240449 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007225 |
|---|
| Name | 3,5-Dihydroxycinnamic acid sulfate |
|---|
| Frequency | 703.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O7S |
|---|
| Molecular Mass | 259.9991 |
|---|
| SMILES | O=C(O)C=Cc1cc(O)cc(OS(=O)(=O)O)c1 |
|---|
| InChI Key | KTPBHOMURDURSV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupsulfuric acid monoestercarboxylic acid1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativephenylsulfateorganic oxidearylsulfateorganic sulfuric acid or derivatives1-hydroxy-4-unsubstituted benzenoidhydroxycinnamic acidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
