| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:29 UTC |
|---|
| Update Date | 2025-03-21 17:57:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007252 |
|---|
| Frequency | 699.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H26O5 |
|---|
| Molecular Mass | 346.178 |
|---|
| SMILES | COc1cccc(CC(CO)C(CO)Cc2ccc(O)c(OC)c2)c1 |
|---|
| InChI Key | GGVSGMCXMALBFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | dibenzylbutane lignans |
|---|
| Subclass | dibenzylbutane lignans |
|---|
| Direct Parent | dibenzylbutane lignans |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisoleshydrocarbon derivativesmethoxybenzenesmethoxyphenolsphenoxy compoundsprimary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethermethoxybenzenearomatic homomonocyclic compounddibenzylbutane lignan skeletonorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundprimary alcoholorganooxygen compound |
|---|