| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:29 UTC |
|---|
| Update Date | 2025-03-21 17:57:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007259 |
|---|
| Frequency | 699.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11O8P |
|---|
| Molecular Mass | 230.0192 |
|---|
| SMILES | O=P(O)(O)OCC1(O)OCC(O)C1O |
|---|
| InChI Key | XALHHFQIICWKJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranpentose phosphatepentose-5-phosphateoxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound1,2-diol |
|---|