| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:30 UTC |
|---|
| Update Date | 2025-03-21 17:57:21 UTC |
|---|
| HMDB ID | HMDB0006809 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007287 |
|---|
| Name | Nicotinic acid ribonucleoside |
|---|
| Frequency | 696.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14NO6+ |
|---|
| Molecular Mass | 256.0816 |
|---|
| SMILES | O=C(O)c1ccc[n+](C2OC(CO)C(O)C2O)c1 |
|---|
| InChI Key | PUEDDPCUCPRQNY-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridine-3-carboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonocarboxylic acids and derivativesmonosaccharidesorganic cationsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundpyridine-3-carboxylic acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationprimary alcoholalcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundhydroxypyridineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
