| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:31 UTC |
|---|
| Update Date | 2025-03-21 17:57:21 UTC |
|---|
| HMDB ID | HMDB0250768 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007318 |
|---|
| Name | 2-Keto-3-Deoxy-D-Mannooctanoic Acid |
|---|
| Frequency | 692.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14O8 |
|---|
| Molecular Mass | 238.0689 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(C(O)CO)O1 |
|---|
| InChI Key | NNLZBVFSCVTSLA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidorganic oxidealiphatic heteromonocyclic compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundc-glucuronidealcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|
