Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:36:33 UTC |
---|
Update Date | 2025-03-21 17:57:22 UTC |
---|
HMDB ID | HMDB0245255 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00007397 |
---|
Name | 2-Nitrobenzoic acid |
---|
Frequency | 682.4 |
---|
Structure | |
---|
Chemical Formula | C7H5NO4 |
---|
Molecular Mass | 167.0219 |
---|
SMILES | O=C(O)c1ccccc1[N+](=O)[O-] |
---|
InChI Key | SLAMLWHELXOEJZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | nitrobenzoic acids and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesnitroaromatic compoundsnitrobenzenesorganic oxidesorganic oxoanionic compoundsorganic oxoazanium compoundsorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
---|
Substituents | carboxylic acidallyl-type 1,3-dipolar organic compoundbenzoylcarboxylic acid derivativeorganic nitro compoundpropargyl-type 1,3-dipolar organic compoundorganic oxidec-nitro compoundorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundorganic oxoazaniumbenzoic acidnitrobenzenenitroaromatic compoundorganic 1,3-dipolar compoundaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundnitrobenzoateorganooxygen compoundorganic hyponitrite |
---|