Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:36:33 UTC |
---|
Update Date | 2025-03-21 17:57:23 UTC |
---|
HMDB ID | HMDB0126638 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00007422 |
---|
Name | 3,4,5-trihydroxy-6-(3,4,5-trihydroxybenzoyloxy)oxane-2-carboxylic acid |
---|
Frequency | 680.4 |
---|
Structure | |
---|
Chemical Formula | C13H14O11 |
---|
Molecular Mass | 346.0536 |
---|
SMILES | O=C(OC1OC(C(=O)O)C(O)C(O)C1O)c1cc(O)c(O)c(O)c1 |
---|
InChI Key | BPMQPBILANRQCU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | tannins |
---|
Subclass | tannins |
---|
Direct Parent | tannins |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidspyrogallols and derivativessecondary alcoholsm-hydroxybenzoic acid estersp-hydroxybenzoic acid alkyl esters |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundp-hydroxybenzoic acid esterbenzoylo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidebenzoate estercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxidetanninacetaloxanem-hydroxybenzoic acid esterorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativespyrogallol derivativebenzenetriolbenzoic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidp-hydroxybenzoic acid alkyl esteroxacycleorganic oxygen compoundpyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|