| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:34 UTC |
|---|
| Update Date | 2025-03-21 17:57:22 UTC |
|---|
| HMDB ID | HMDB0246379 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007446 |
|---|
| Name | 4-Biphenylcarboxylic acid |
|---|
| Frequency | 678.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O2 |
|---|
| Molecular Mass | 198.0681 |
|---|
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1 |
|---|
| InChI Key | NNJMFJSKMRYHSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | carboxylic acidbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzoic acidorganooxygen compound |
|---|
