| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:44 UTC |
|---|
| Update Date | 2025-03-21 17:57:26 UTC |
|---|
| HMDB ID | HMDB0245171 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007828 |
|---|
| Name | 2-Hydroxyterephthalic acid |
|---|
| Frequency | 635.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6O5 |
|---|
| Molecular Mass | 182.0215 |
|---|
| SMILES | O=C(O)c1ccc(C(=O)O)c(O)c1 |
|---|
| InChI Key | CDOWNLMZVKJRSC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-phthalic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundssalicylic acidsvinylogous acids |
|---|
| Substituents | carboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativehydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundsalicylic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compoundpara_phthalic_acid |
|---|
