| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:46 UTC |
|---|
| Update Date | 2025-03-21 17:57:26 UTC |
|---|
| HMDB ID | HMDB0240528 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007906 |
|---|
| Name | Homovanillyl alcohol sulfate |
|---|
| Frequency | 627.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O6S |
|---|
| Molecular Mass | 248.0355 |
|---|
| SMILES | COc1cc(CCO)ccc1OS(=O)(=O)O |
|---|
| InChI Key | LWTDOJAWTHMBFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl aryl ethersanisoleshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundssulfuric acid monoesterstyrosols and derivatives |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietysulfuric acid monoesteretheralkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundanisolesulfate-esterhydrocarbon derivativebenzenoidtyrosol derivativephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
