Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:36:47 UTC |
---|
Update Date | 2025-03-21 17:57:27 UTC |
---|
HMDB ID | HMDB0059974 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00007938 |
---|
Name | 4-Hydroxy-5-(3',5'-dihydroxyphenyl)-valeric acid-O-methyl-O-glucuronide |
---|
Frequency | 625.0 |
---|
Structure | |
---|
Chemical Formula | C18H26O12 |
---|
Molecular Mass | 434.1424 |
---|
SMILES | O=C(CCC(O)Cc1cc(O)cc(O)c1)OCOC1OC(C(O)O)C(O)C(O)C1O |
---|
InChI Key | NLJOFAILECLFIF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | phenols |
---|
Subclass | benzenediols |
---|
Direct Parent | resorcinols |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativescarbonyl compoundscarbonyl hydratescarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarbonyl hydratearomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativeresorcinolsaccharideorganic oxideacetaloxaneorganoheterocyclic compoundalcohol1-hydroxy-4-unsubstituted benzenoidoxacyclefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
---|