| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:48 UTC |
|---|
| Update Date | 2025-03-21 17:57:27 UTC |
|---|
| HMDB ID | HMDB0251455 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00007985 |
|---|
| Name | Diphenylacetic acid |
|---|
| Frequency | 620.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O2 |
|---|
| Molecular Mass | 212.0837 |
|---|
| SMILES | O=C(O)C(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | PYHXGXCGESYPCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
