| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:49 UTC |
|---|
| Update Date | 2025-03-21 17:57:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008045 |
|---|
| Frequency | 615.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O8P |
|---|
| Molecular Mass | 228.0035 |
|---|
| SMILES | O=C(O)CCC(OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | MZGBIOWKDIUFFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | short-chain hydroxy acids and derivatives |
|---|
| Direct Parent | short-chain hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesmonoalkyl phosphatesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidfatty acidcarboxylic acid derivativeorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatedicarboxylic acid or derivativeshydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
