Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:36:50 UTC |
---|
Update Date | 2025-03-21 17:57:28 UTC |
---|
HMDB ID | HMDB0240458 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00008076 |
---|
Name | 4-Methylcatechol 1-glucuronide |
---|
Frequency | 612.9 |
---|
Structure | |
---|
Chemical Formula | C13H16O8 |
---|
Molecular Mass | 300.0845 |
---|
SMILES | Cc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)c(O)c1 |
---|
InChI Key | PLHZIQGSGAGOQO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmeta cresolsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholstoluenes |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesm-cresolhydroxy acid1-hydroxy-4-unsubstituted benzenoidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundtoluene |
---|