| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:51 UTC |
|---|
| Update Date | 2025-03-21 17:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008098 |
|---|
| Frequency | 611.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17NO6 |
|---|
| Molecular Mass | 295.1056 |
|---|
| SMILES | O=C(O)CCC(NC(Cc1ccccc1)C(=O)O)C(=O)O |
|---|
| InChI Key | HXHOXUIZVFYTTR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkylaminesglutamic acid and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylpropanoic acidstricarboxylic acids and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidamino acidtricarboxylic acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativessecondary aliphatic amineglutamic acid or derivativessecondary aminearomatic homomonocyclic compoundphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|