| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:36:51 UTC |
|---|
| Update Date | 2025-03-21 17:57:28 UTC |
|---|
| HMDB ID | HMDB0006040 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008114 |
|---|
| Name | N2-Methylguanine |
|---|
| Frequency | 928.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7N5O |
|---|
| Molecular Mass | 165.0651 |
|---|
| SMILES | CNc1nc(=O)c2nc[nH]c2[nH]1 |
|---|
| InChI Key | SGSSKEDGVONRGC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesorganic oxidesorganooxygen compoundsorganopnictogen compoundspurines and purine derivativespyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | vinylogous amideazacycleheteroaromatic compoundpyrimidonesecondary aminesecondary aliphatic/aromatic aminepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamineazole |
|---|
