| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:36:53 UTC |
|---|
| Update Date | 2025-03-21 17:57:29 UTC |
|---|
| HMDB ID | HMDB0001314 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008181 |
|---|
| Name | Cyclic GMP |
|---|
| Frequency | 992.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N5O7P |
|---|
| Molecular Mass | 345.0474 |
|---|
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC3C2O)c(=O)[nH]1 |
|---|
| InChI Key | ZOOGRGPOEVQQDX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | cyclic purine nucleotides |
|---|
| Direct Parent | 3',5'-cyclic purine nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactampentose phosphatemonosaccharidepyrimidoneimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compound3',5'-cyclic purine ribonucleotideoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativepurineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|