Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:36:53 UTC |
---|
Update Date | 2025-03-21 17:57:29 UTC |
---|
HMDB ID | HMDB0001314 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00008181 |
---|
Name | Cyclic GMP |
---|
Frequency | 992.0 |
---|
Structure | |
---|
Chemical Formula | C10H12N5O7P |
---|
Molecular Mass | 345.0474 |
---|
SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC3C2O)c(=O)[nH]1 |
---|
InChI Key | ZOOGRGPOEVQQDX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | purine nucleotides |
---|
Subclass | cyclic purine nucleotides |
---|
Direct Parent | 3',5'-cyclic purine nucleotides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
---|
Substituents | lactampentose phosphatemonosaccharidepyrimidoneimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compound3',5'-cyclic purine ribonucleotideoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativepurineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
---|