| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:36:55 UTC |
|---|
| Update Date | 2025-03-21 17:57:30 UTC |
|---|
| HMDB ID | HMDB0124978 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008254 |
|---|
| Name | (5-ethenyl-2-hydroxyphenyl)oxidanesulfonic acid |
|---|
| Frequency | 595.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O5S |
|---|
| Molecular Mass | 216.0092 |
|---|
| SMILES | C=Cc1ccc(O)c(OS(=O)(=O)O)c1 |
|---|
| InChI Key | WJSNOGSNIHAQKB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoester1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
