| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:55 UTC |
|---|
| Update Date | 2025-03-21 17:57:30 UTC |
|---|
| HMDB ID | HMDB0255850 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008270 |
|---|
| Name | O-Demethylmetoprolol |
|---|
| Frequency | 594.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23NO3 |
|---|
| Molecular Mass | 253.1678 |
|---|
| SMILES | CC(C)NCC(O)COc1ccc(CCO)cc1 |
|---|
| InChI Key | CUKXSBOAIJILRY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersdialkylamineshydrocarbon derivativesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic aminemonocyclic benzene moietyetheralkyl aryl ethersecondary aminearomatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativetyrosol derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compoundamine |
|---|
