| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:55 UTC |
|---|
| Update Date | 2025-03-21 17:57:30 UTC |
|---|
| HMDB ID | HMDB0004195 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008277 |
|---|
| Name | 5-L-Glutamyl-taurine |
|---|
| Frequency | 611.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14N2O6S |
|---|
| Molecular Mass | 254.0573 |
|---|
| SMILES | NC(CCC(=O)NCCS(=O)(=O)O)C(=O)O |
|---|
| InChI Key | WGXUDTHMEITUBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidssecondary carboxylic acid amidessulfonyls |
|---|
| Substituents | fatty acylaliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidglutamine or derivativesorganosulfonic acidfatty amidefatty acidorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundcarboxamide groupn-acyl-aminesecondary carboxylic acid amidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
