| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:36:56 UTC | 
|---|
| Update Date | 2025-03-21 17:57:30 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00008305 | 
|---|
| Frequency | 591.3 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C4H8NO7P | 
|---|
| Molecular Mass | 213.0038 | 
|---|
| SMILES | O=C(O)CC(NP(=O)(O)O)C(=O)O | 
|---|
| InChI Key | NVFHUBRALOJXMJ-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic acids and derivatives | 
|---|
| Class | carboxylic acids and derivatives | 
|---|
| Subclass | amino acids, peptides, and analogues | 
|---|
| Direct Parent | aspartic acid and derivatives | 
|---|
| Geometric Descriptor | aliphatic acyclic compounds | 
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compounds | 
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty acidorganic oxideorganic oxygen compoundaspartic acid or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganic phosphoric acid amideorganooxygen compound | 
|---|