| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:36:56 UTC | 
|---|
| Update Date | 2025-03-21 17:57:30 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00008325 | 
|---|
| Frequency | 589.6 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C16H24O3 | 
|---|
| Molecular Mass | 264.1725 | 
|---|
| SMILES | CCCCCCCCCc1cccc(O)c1C(=O)O | 
|---|
| InChI Key | XIWIZLRSXVMDLX-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | benzenoids | 
|---|
| Class | benzene and substituted derivatives | 
|---|
| Subclass | benzoic acids and derivatives | 
|---|
| Direct Parent | salicylic acids | 
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsvinylogous acids | 
|---|
| Substituents | carboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound | 
|---|