| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:57 UTC |
|---|
| Update Date | 2025-03-21 17:57:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008353 |
|---|
| Frequency | 587.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O12P2 |
|---|
| Molecular Mass | 337.9804 |
|---|
| SMILES | O=C1OC(COP(=O)(O)OP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | NWFAFKKYHDPJOL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdelta valerolactonesgluconolactoneshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic pyrophosphatesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | carbonyl groupdelta valerolactonecarboxylic acid derivativelactoneorganic oxidegluconolactonealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compoundalcoholorganic pyrophosphateoxacyclemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhexose phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
