| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:58 UTC |
|---|
| Update Date | 2025-03-21 17:57:31 UTC |
|---|
| HMDB ID | HMDB0010362 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008392 |
|---|
| Name | 6-Hydroxy-5-methoxyindole glucuronide |
|---|
| Frequency | 584.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO8 |
|---|
| Molecular Mass | 339.0954 |
|---|
| SMILES | COc1cc2cc[nH]c2cc1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | NECCHCPFFUXUOB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidspyrrolessecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidindoleo-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesazacycleheteroaromatic compoundindole or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyrananisolepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
