| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:01 UTC |
|---|
| Update Date | 2025-03-21 17:57:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008485 |
|---|
| Frequency | 577.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO4 |
|---|
| Molecular Mass | 301.1314 |
|---|
| SMILES | CN1CCc2cc(O)c(O)cc2C1Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | VHRSWCTVFBWHKE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | benzylisoquinolines |
|---|
| Direct Parent | benzylisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaralkylaminesazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesorganooxygen compoundsorganopnictogen compoundstetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | monocyclic benzene moietyazacycletertiary aliphatic amine1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidbenzylisoquinolinearalkylamineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
