| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:05 UTC |
|---|
| Update Date | 2025-03-21 17:57:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008647 |
|---|
| Frequency | 614.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11NO3 |
|---|
| Molecular Mass | 229.0739 |
|---|
| SMILES | O=C(Nc1ccc(O)cc1)c1ccccc1O |
|---|
| InChI Key | LGCMKPRGGJRYGM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssalicylamidessecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | benzanilidebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsalicylamidearomatic homomonocyclic compoundsecondary carboxylic acid amidevinylogous acidorganic oxygen compoundsalicylic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
