Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:37:05 UTC |
---|
Update Date | 2025-03-21 17:57:34 UTC |
---|
HMDB ID | HMDB0245554 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00008679 |
---|
Name | 2',5'-Dideoxyadenosine |
---|
Frequency | 563.4 |
---|
Structure | |
---|
Chemical Formula | C10H13N5O2 |
---|
Molecular Mass | 235.1069 |
---|
SMILES | CC1OC(n2cnc3c(N)ncnc32)CC1O |
---|
InChI Key | FFHPXOJTVQDVMO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | 2',5'-dideoxyribonucleosides |
---|
Subclass | 2',5'-dideoxyribonucleosides |
---|
Direct Parent | 2',5'-dideoxyribonucleosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
---|
Substituents | 2',5'-dideoxyribonucleosidemonosaccharideimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
---|