Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:37:06 UTC |
---|
Update Date | 2025-03-21 17:57:34 UTC |
---|
HMDB ID | HMDB0133330 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00008716 |
---|
Name | 7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one |
---|
Frequency | 560.6 |
---|
Structure | |
---|
Chemical Formula | C16H12O5 |
---|
Molecular Mass | 284.0685 |
---|
SMILES | COc1cc(-c2cc(=O)c3ccc(O)cc3o2)ccc1O |
---|
InChI Key | OUMMPAFEQHTYIZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | o-methylated flavonoids |
---|
Direct Parent | 3'-o-methylated flavonoids |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
---|
Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compoundmethoxybenzene3p-methoxyflavonoid-skeletonoxacycleorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
---|