| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:37:07 UTC |
|---|
| Update Date | 2025-03-21 17:57:34 UTC |
|---|
| HMDB ID | HMDB0302469 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008737 |
|---|
| Name | Vanillic acid 4-beta-D-glucoside |
|---|
| Frequency | 559.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O9 |
|---|
| Molecular Mass | 330.0951 |
|---|
| SMILES | COc1cc(C(=O)O)ccc1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | JYFOSWJYZIVJPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | tannins |
|---|
| Subclass | hydrolyzable tannins |
|---|
| Direct Parent | hydrolyzable tannins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesm-methoxybenzoic acids and derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietyethercarboxylic acidaromatic heteromonocyclic compoundbenzoylmonosaccharidealkyl aryl ethercarboxylic acid derivativesaccharideorganic oxideacetalbenzoic acidm-methoxybenzoic acid or derivativesoxaneprimary alcoholorganoheterocyclic compoundhydrolyzable tanninalcoholbenzoic acid or derivativesmethoxybenzeneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|