| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:07 UTC |
|---|
| Update Date | 2025-03-21 17:57:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008753 |
|---|
| Frequency | 557.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H9NO9P2 |
|---|
| Molecular Mass | 264.9753 |
|---|
| SMILES | NC(COP(=O)(O)O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | PBSOZUWSYLCKQT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatescarbonyl compoundshydrocarbon derivativesmonoalkyl phosphatesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolamines |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupacyl monophosphatephosphoethanolamineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphateorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundacyl phosphate |
|---|
