| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:37:09 UTC |
|---|
| Update Date | 2025-03-21 17:57:35 UTC |
|---|
| HMDB ID | HMDB0013189 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008819 |
|---|
| Name | 3-Indole carboxylic acid glucuronide |
|---|
| Frequency | 552.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO8 |
|---|
| Molecular Mass | 337.0798 |
|---|
| SMILES | O=C(OC1OC(C(=O)O)C(O)C(O)C1O)c1c[nH]c2ccccc12 |
|---|
| InChI Key | BDNWJTRKUBXAGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsbenzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesindolecarboxylic acids and derivativesindolesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidspyrrole carboxylic acids and derivativessecondary alcoholsvinylogous amides |
|---|
| Substituents | carbonyl groupcarboxylic acidpyrrole-3-carboxylic acid or derivativesindoleo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundindolecarboxylic acid derivativealcoholvinylogous amidepyran carboxylic acid or derivativesazacycleheteroaromatic compoundindole or derivativeshydroxy acidoxacyclepyrancarboxylic acid esterpyrrolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|