| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:37:12 UTC |
|---|
| Update Date | 2025-03-21 17:57:36 UTC |
|---|
| HMDB ID | HMDB0006801 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008936 |
|---|
| Name | 2-Oxo-3-hydroxy-4-phosphobutanoic acid |
|---|
| Frequency | 542.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O8P |
|---|
| Molecular Mass | 213.9879 |
|---|
| SMILES | O=C(O)C(=O)C(O)COP(=O)(O)O |
|---|
| InChI Key | MZJFVXDTNBHTKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | short-chain keto acids and derivatives |
|---|
| Direct Parent | short-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesalpha-keto acids and derivativesbeta hydroxy acids and derivativescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidmonosaccharideshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativeketonebeta-hydroxy acidsaccharideorganic oxidealpha-keto acidalcoholhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphateacyloinsecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
