| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:37:12 UTC |
|---|
| Update Date | 2025-03-21 17:57:36 UTC |
|---|
| HMDB ID | HMDB0257981 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008943 |
|---|
| Name | [(3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|
| Frequency | 542.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H13O14P3 |
|---|
| Molecular Mass | 389.9518 |
|---|
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC1OC(CO)C(O)C1O |
|---|
| InChI Key | GSWQANXOEXVPDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
