| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:13 UTC |
|---|
| Update Date | 2025-03-21 17:57:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00008979 |
|---|
| Frequency | 539.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7O6P |
|---|
| Molecular Mass | 217.998 |
|---|
| SMILES | O=C(O)c1ccc(OP(=O)(O)O)cc1 |
|---|
| InChI Key | FBXJLZYWIAOHFO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phenyl phosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidbenzoylbenzoic acid or derivativesphenyl phosphatecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidbenzoic acidphenoxy compoundorganooxygen compound |
|---|
