| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:37:17 UTC |
|---|
| Update Date | 2025-03-21 17:57:38 UTC |
|---|
| HMDB ID | HMDB0246627 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009155 |
|---|
| Name | 4'-Demethylepipodophyllotoxin |
|---|
| Frequency | 529.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O8 |
|---|
| Molecular Mass | 400.1158 |
|---|
| SMILES | COc1cc(C2c3cc4c(cc3C(O)C3COC(=O)C23)OCO4)cc(OC)c1O |
|---|
| InChI Key | YVCVYCSAAZQOJI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | podophyllotoxins |
|---|
| Direct Parent | podophyllotoxins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesaryltetralin lignansbenzodioxolescarbonyl compoundscarboxylic acid estersdimethoxybenzenesfuranonaphthodioxolesgamma butyrolactoneshydrocarbon derivativesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundssecondary alcoholstetrahydrofuranstetralins |
|---|
| Substituents | linear furanonaphthodioxoletetralinphenol ethermonocyclic benzene moietycarbonyl groupetherpodophyllotoxinmethoxyphenol1-aryltetralin lignanalkyl aryl ethercarboxylic acid derivativelactonedimethoxybenzeneorganic oxideacetalaromatic heteropolycyclic compoundorganoheterocyclic compoundbenzodioxolealcoholnaphthofurantetrahydrofuranmethoxybenzenegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundm-dimethoxybenzeneanisolecarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
