| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:37:19 UTC |
|---|
| Update Date | 2025-03-21 17:57:38 UTC |
|---|
| HMDB ID | HMDB0001127 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009225 |
|---|
| Name | 6-Phosphonoglucono-D-lactone |
|---|
| Frequency | 525.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O9P |
|---|
| Molecular Mass | 258.0141 |
|---|
| SMILES | O=C1OC(COP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | IJOJIVNDFQSGAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdelta valerolactonesgluconolactoneshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | carbonyl groupdelta valerolactonecarboxylic acid derivativelactoneorganic oxidegluconolactonealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compoundalcoholoxacyclemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhexose phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
