| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:37:20 UTC | 
|---|
| Update Date | 2025-03-21 17:57:38 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00009249 | 
|---|
| Frequency | 523.1 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C12H15NO4 | 
|---|
| Molecular Mass | 237.1001 | 
|---|
| SMILES | O=C(O)CN=C(O)CCC(O)c1ccccc1 | 
|---|
| InChI Key | OACVGWPDSBCVCY-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic acids and derivatives | 
|---|
| Class | carboxylic acids and derivatives | 
|---|
| Subclass  | amino acids, peptides, and analogues | 
|---|
| Direct Parent  | alpha amino acids | 
|---|
| Geometric Descriptor  | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents  | aromatic alcoholsbenzene and substituted derivativescarbonyl compoundscarboximidic acidscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary alcohols | 
|---|
| Substituents  | aromatic alcoholalcoholcarboximidic acidmonocyclic benzene moietycarbonyl groupcarboxylic acidorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound | 
|---|