| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:37:20 UTC |
|---|
| Update Date | 2025-03-21 17:57:39 UTC |
|---|
| HMDB ID | HMDB0037921 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009259 |
|---|
| Name | Aureol |
|---|
| Frequency | 521.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H8O6 |
|---|
| Molecular Mass | 284.0321 |
|---|
| SMILES | O=c1oc2cc(O)cc(O)c2c2oc3cc(O)ccc3c12 |
|---|
| InChI Key | WIRRQLQRDSREEG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | coumestans |
|---|
| Direct Parent | coumestans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsangular furanocoumarinsbenzenoidsbenzofuransfuransfuropyransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | furanfuranocoumarinbenzopyranbenzofuran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidfuropyran1-hydroxy-4-unsubstituted benzenoidcoumarinangular furanocoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonecoumestanhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
